Products 332187-56-1

CAS 332187-56-1 appears in our catalog under these names: 3,3-Dimethoxycyclobutanecarboxylic acid 95%, 3,3-Dimethoxycyclobutanecarboxylic acid, 95%, 95%, 3,3-Dimethoxycyclobutanecarboxylic acid, 96%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 500g, 1g, 5g, 10g, 25g, 100g, 50g.

Structural formula: {0} (CAS {1})

3,3-dimethoxycyclobutane-1-carboxylic acid (CAS 332187-56-1) is a chemical compound with the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. IUPAC name: 3,3-dimethoxycyclobutane-1-carboxylic acid. InChIKey: FUBIHPWDLJCHSB-UHFFFAOYSA-N.

Identity
Molecular formulaC7H12O4
Molecular weight160.17 g/mol
IUPAC name3,3-dimethoxycyclobutane-1-carboxylic acid
InChIKeyFUBIHPWDLJCHSB-UHFFFAOYSA-N
SMILESCOC1(CC(C1)C(=O)O)OC

Computed by PubChem (NCBI)