CAS 33239-19-9 appears in our catalog under these names: Diiodofluorescein, 95%, Erythrosin Yellowish. Offered by: Combi-blocks, TRC, Biosynth, MedChemExpress. Available pack sizes: 10g, 50g, 1g, 0,5g, 0,25g, 5g, 2g, Get quote.
Disodium;4',5'-diiodo-3-oxospiro[2-benzofuran-1,9'-xanthene]-3',6'-diolate (CAS 33239-19-9) is a chemical compound with the molecular formula C20H8I2Na2O5 and a molecular weight of 628.1 g/mol. IUPAC name: disodium;4',5'-diiodo-3-oxospiro[2-benzofuran-1,9'-xanthene]-3',6'-diolate. InChIKey: AHSJNHONMVUMLK-UHFFFAOYSA-L.
| Molecular formula | C20H8I2Na2O5 |
|---|---|
| Molecular weight | 628.1 g/mol |
| IUPAC name | disodium;4',5'-diiodo-3-oxospiro[2-benzofuran-1,9'-xanthene]-3',6'-diolate |
| InChIKey | AHSJNHONMVUMLK-UHFFFAOYSA-L |
| SMILES | C1=CC=C2C(=C1)C(=O)OC23C4=C(C(=C(C=C4)[O-])I)OC5=C3C=CC(=C5I)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)