CAS 332398-57-9 appears in our catalog under these names: 4-Borono-1-naphthoic acid, 95-<97%, 4-Borono-1-naphthoic acid, ≥97-<99%, 4-Carboxynaphthalene-1-boronic acid, 95% , 4-Borono-1-naphthoic acid 98%, 4-Borono-1-naphthoic acid, 98%, 98%. Offered by: Hoffman Fine Chemicals, Thermo Scientific (Alfa Aesar), Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 1g, 250mg, 100mg.
4-borononaphthalene-1-carboxylic acid (CAS 332398-57-9) is a chemical compound with the molecular formula C11H9BO4 and a molecular weight of 216.00 g/mol. IUPAC name: 4-borononaphthalene-1-carboxylic acid. InChIKey: SRYYKYNBMCQCAB-UHFFFAOYSA-N.
| Molecular formula | C11H9BO4 |
|---|---|
| Molecular weight | 216.00 g/mol |
| IUPAC name | 4-borononaphthalene-1-carboxylic acid |
| InChIKey | SRYYKYNBMCQCAB-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C2=CC=CC=C12)C(=O)O)(O)O |
Computed by PubChem (NCBI)