CAS 332407-28-0 is the registry number for PI5P4K-β-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-anilino-4-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-1H-imidazol-5-one (CAS 332407-28-0) is a chemical compound with the molecular formula C23H17Cl2N3O2 and a molecular weight of 438.3 g/mol. IUPAC name: 2-anilino-4-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-1H-imidazol-5-one. InChIKey: NYIMWDWEKSPBAR-UHFFFAOYSA-N.
| Molecular formula | C23H17Cl2N3O2 |
|---|---|
| Molecular weight | 438.3 g/mol |
| IUPAC name | 2-anilino-4-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-1H-imidazol-5-one |
| InChIKey | NYIMWDWEKSPBAR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC(=CC3=CC(=CC=C3)OCC4=C(C=C(C=C4)Cl)Cl)C(=O)N2 |
Computed by PubChem (NCBI)