CAS 3327-61-5 is the registry number for Tms-alpha-d-(+)-glucose, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-trimethylsilyloxyoxane-3,4,5-triol (CAS 3327-61-5) is a chemical compound with the molecular formula C9H20O6Si and a molecular weight of 252.34 g/mol. IUPAC name: (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-trimethylsilyloxyoxane-3,4,5-triol. InChIKey: HCWAILZFCRLWPS-SYHAXYEDSA-N.
| Molecular formula | C9H20O6Si |
|---|---|
| Molecular weight | 252.34 g/mol |
| IUPAC name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-trimethylsilyloxyoxane-3,4,5-triol |
| InChIKey | HCWAILZFCRLWPS-SYHAXYEDSA-N |
| SMILES | C[Si](C)(C)O[C@@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)