CAS 332903-68-1 is the registry number for 2-Chloro-N-(4-ethylphenyl)-N-(2,3,5,6-tetrafluorophenyl)acetamide. Offered by: TRC. Available pack sizes: 2,5g, 250mg.
2-chloro-N-(4-ethylphenyl)-N-(2,3,5,6-tetrafluorophenyl)acetamide (CAS 332903-68-1) is a chemical compound with the molecular formula C16H12ClF4NO and a molecular weight of 345.72 g/mol. IUPAC name: 2-chloro-N-(4-ethylphenyl)-N-(2,3,5,6-tetrafluorophenyl)acetamide. InChIKey: XXNJYZYKTNBAPC-UHFFFAOYSA-N.
| Molecular formula | C16H12ClF4NO |
|---|---|
| Molecular weight | 345.72 g/mol |
| IUPAC name | 2-chloro-N-(4-ethylphenyl)-N-(2,3,5,6-tetrafluorophenyl)acetamide |
| InChIKey | XXNJYZYKTNBAPC-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)N(C2=C(C(=CC(=C2F)F)F)F)C(=O)CCl |
Computed by PubChem (NCBI)