CAS 332904-33-3 is the registry number for 1-(6-amino-2,2,4-trimethyl-4-phenyl-3,4-dihydroquinolin-1(2H)-yl)ethanone, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(6-amino-2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)ethanone (CAS 332904-33-3) is a chemical compound with the molecular formula C20H24N2O and a molecular weight of 308.4 g/mol. IUPAC name: 1-(6-amino-2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)ethanone. InChIKey: RTWPATFTOPMBPW-UHFFFAOYSA-N.
| Molecular formula | C20H24N2O |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | 1-(6-amino-2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)ethanone |
| InChIKey | RTWPATFTOPMBPW-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C2=C(C=C(C=C2)N)C(CC1(C)C)(C)C3=CC=CC=C3 |
Computed by PubChem (NCBI)