Products 333-29-9

CAS 333-29-9 is the registry number for Cyloone, Concentration: 100 µg/ml Solvent: Methanol. Offered by: HPC Standards. Available pack sizes: 1x1ml.

Structural formula: {0} (CAS {1})

N-diethoxyphosphinothioyl-1,3-dithiolan-2-imine (CAS 333-29-9) is a chemical compound with the molecular formula C7H14NO2PS3 and a molecular weight of 271.4 g/mol. IUPAC name: N-diethoxyphosphinothioyl-1,3-dithiolan-2-imine. InChIKey: YWITZONHXPIYDK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14NO2PS3
Molecular weight271.4 g/mol
IUPAC nameN-diethoxyphosphinothioyl-1,3-dithiolan-2-imine
InChIKeyYWITZONHXPIYDK-UHFFFAOYSA-N
SMILESCCOP(=S)(N=C1SCCS1)OCC

Computed by PubChem (NCBI)