CAS 333-31-3 appears in our catalog under these names: Methacholine bromide, 98%, Methacholine bromide, Methacholine bromide, Acetyl-beta-methylcholine bromide, 99%, Methacholine Bromide, >99.0%(T). Offered by: Combi-blocks, GLPBio, Biosynth, Thermo Scientific (Acros), TCI. Available pack sizes: 1g, 25g, 5g, 100g, 50g, Get quote.
2-acetyloxypropyl(trimethyl)azanium bromide (CAS 333-31-3) is a chemical compound with the molecular formula C8H18BrNO2 and a molecular weight of 240.14 g/mol. IUPAC name: 2-acetyloxypropyl(trimethyl)azanium bromide. InChIKey: MMVPLEUBMWUYIB-UHFFFAOYSA-M.
| Molecular formula | C8H18BrNO2 |
|---|---|
| Molecular weight | 240.14 g/mol |
| IUPAC name | 2-acetyloxypropyl(trimethyl)azanium bromide |
| InChIKey | MMVPLEUBMWUYIB-UHFFFAOYSA-M |
| SMILES | CC(C[N+](C)(C)C)OC(=O)C.[Br-] |
Computed by PubChem (NCBI)