CAS 3330-15-2 appears in our catalog under these names: Heptafluoropropyl 1,2,2,2-tetrafluoroethyl ether, 95%, Heptafluoropropyl 1,2,2,2-Tetrafluoroethyl Ether, Heptafluoropropyl 1,2,2,2-tetrafluoroethyl ether, 97%, 97%, GenX E1. Offered by: Combi-blocks, Biosynth, Chemat, HPC Standards. Available pack sizes: 5g, 100g, 25g, 1g, 1x10mg.
1,1,1,2,2,3,3-heptafluoro-3-(1,2,2,2-tetrafluoroethoxy)propane (CAS 3330-15-2) is a chemical compound with the molecular formula C5HF11O and a molecular weight of 286.04 g/mol. IUPAC name: 1,1,1,2,2,3,3-heptafluoro-3-(1,2,2,2-tetrafluoroethoxy)propane. InChIKey: CUTPKDUMZWIJKT-UHFFFAOYSA-N.
| Molecular formula | C5HF11O |
|---|---|
| Molecular weight | 286.04 g/mol |
| IUPAC name | 1,1,1,2,2,3,3-heptafluoro-3-(1,2,2,2-tetrafluoroethoxy)propane |
| InChIKey | CUTPKDUMZWIJKT-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)F)(OC(C(C(F)(F)F)(F)F)(F)F)F |
Computed by PubChem (NCBI)