CAS 3333-23-1 appears in our catalog under these names: 3,4-Dihydronaphthalene-1-carboxylic acid 98%, 3,4-Dihydronaphthalene-1-carboxylic acid, 98%, 98%, 3,4-dihydro-Naphthoic Acid. Offered by: Ambeed, Chemat, Chemat Brand. Available pack sizes: 50mg, 100mg, 250mg, 1g, on request.
3,4-dihydronaphthalene-1-carboxylic acid (CAS 3333-23-1) is a chemical compound with the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. IUPAC name: 3,4-dihydronaphthalene-1-carboxylic acid. InChIKey: JNPFDSPGHQBUPF-UHFFFAOYSA-N.
| Molecular formula | C11H10O2 |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 3,4-dihydronaphthalene-1-carboxylic acid |
| InChIKey | JNPFDSPGHQBUPF-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC=C2C(=C1)C(=O)O |
Computed by PubChem (NCBI)