CAS 3333-46-8 appears in our catalog under these names: D-Tartaric Acid Monomethyl Ester, Tartaric Acid Methyl Ester, >95% (HPLC), Tartaric acid methyl ester. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 250mg, 500mg.
(2R,3R)-2,3-dihydroxy-4-methoxy-4-oxobutanoic acid (CAS 3333-46-8) is a chemical compound with the molecular formula C5H8O6 and a molecular weight of 164.11 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxy-4-methoxy-4-oxobutanoic acid. InChIKey: GBJFSZCDZHSAOP-PWNYCUMCSA-N.
| Molecular formula | C5H8O6 |
|---|---|
| Molecular weight | 164.11 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxy-4-methoxy-4-oxobutanoic acid |
| InChIKey | GBJFSZCDZHSAOP-PWNYCUMCSA-N |
| SMILES | COC(=O)[C@@H]([C@H](C(=O)O)O)O |
Computed by PubChem (NCBI)