Products 333329-22-9
CAS 333329-22-9 is the registry number for CD73-IN-19. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 4-[(3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carbonyl)amino]benzoate (CAS 333329-22-9) is a chemical compound with the molecular formula C18H17N3O3S and a molecular weight of 355.4 g/mol. IUPAC name: methyl 4-[(3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carbonyl)amino]benzoate. InChIKey: JRHYTFDGNPAZEZ-UHFFFAOYSA-N.
| Molecular formula | C18H17N3O3S |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | methyl 4-[(3-amino-4,6-dimethylthieno[2,3-b]pyridine-2-carbonyl)amino]benzoate |
| InChIKey | JRHYTFDGNPAZEZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C(=C(S2)C(=O)NC3=CC=C(C=C3)C(=O)OC)N)C |
Computed by PubChem (NCBI)