CAS 333415-38-6 appears in our catalog under these names: 7-[(4-tert-Butylphenyl)methyl]-1,3-dimethyl-2,3,6,7-tetrahydro-1h-purine-2,6-dione, 95%, VU0071063/ 99.99%, VU0071063, 7-(4-(tert-Butyl)benzyl)-1,3-dimethyl-1H-purine-2,6(3H,7H)-dione, 95%, 95%, VU0071063, 99.71%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 5mg, 10mg, 25mg, 50mg, 200mg, 1mg, 25 mg.
7-[(4-tert-butylphenyl)methyl]-1,3-dimethylpurine-2,6-dione (CAS 333415-38-6) is a chemical compound with the molecular formula C18H22N4O2 and a molecular weight of 326.4 g/mol. IUPAC name: 7-[(4-tert-butylphenyl)methyl]-1,3-dimethylpurine-2,6-dione. InChIKey: ZFZAIHKQJBMYLO-UHFFFAOYSA-N.
| Molecular formula | C18H22N4O2 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 7-[(4-tert-butylphenyl)methyl]-1,3-dimethylpurine-2,6-dione |
| InChIKey | ZFZAIHKQJBMYLO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)CN2C=NC3=C2C(=O)N(C(=O)N3C)C |
Computed by PubChem (NCBI)