CAS 333441-46-6 is the registry number for 2-(((4-Bromophenyl)sulfonyl)amino)benzamide. Offered by: Biosynth. Available pack sizes: 10g, 25g.
2-[(4-bromophenyl)sulfonylamino]benzamide (CAS 333441-46-6) is a chemical compound with the molecular formula C13H11BrN2O3S and a molecular weight of 355.21 g/mol. IUPAC name: 2-[(4-bromophenyl)sulfonylamino]benzamide. InChIKey: ZUCKAUQEOKRCBL-UHFFFAOYSA-N.
| Molecular formula | C13H11BrN2O3S |
|---|---|
| Molecular weight | 355.21 g/mol |
| IUPAC name | 2-[(4-bromophenyl)sulfonylamino]benzamide |
| InChIKey | ZUCKAUQEOKRCBL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)N)NS(=O)(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)