CAS 333453-15-9 is the registry number for Methyl n-(5-chloro-2-methylphenyl)-n-[(4-methylphenyl)sulfonyl]glycinate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-(5-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)acetate (CAS 333453-15-9) is a chemical compound with the molecular formula C17H18ClNO4S and a molecular weight of 367.8 g/mol. IUPAC name: methyl 2-(5-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)acetate. InChIKey: WLYIXQGVDYFNOU-UHFFFAOYSA-N.
| Molecular formula | C17H18ClNO4S |
|---|---|
| Molecular weight | 367.8 g/mol |
| IUPAC name | methyl 2-(5-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)acetate |
| InChIKey | WLYIXQGVDYFNOU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N(CC(=O)OC)C2=C(C=CC(=C2)Cl)C |
Computed by PubChem (NCBI)