Products 333456-56-7

CAS 333456-56-7 is the registry number for N-(2-Ethoxyphenyl)-n-[(4-methylphenyl)sulfonyl]glycine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(2-ethoxy-N-(4-methylphenyl)sulfonylanilino)acetic acid (CAS 333456-56-7) is a chemical compound with the molecular formula C17H19NO5S and a molecular weight of 349.4 g/mol. IUPAC name: 2-(2-ethoxy-N-(4-methylphenyl)sulfonylanilino)acetic acid. InChIKey: RZFZYQPXQKVPTM-UHFFFAOYSA-N.

Identity
Molecular formulaC17H19NO5S
Molecular weight349.4 g/mol
IUPAC name2-(2-ethoxy-N-(4-methylphenyl)sulfonylanilino)acetic acid
InChIKeyRZFZYQPXQKVPTM-UHFFFAOYSA-N
SMILESCCOC1=CC=CC=C1N(CC(=O)O)S(=O)(=O)C2=CC=C(C=C2)C

Computed by PubChem (NCBI)