CAS 3335-15-7 appears in our catalog under these names: 2-Oxo-4,6-bis(trifluoromethyl)-1,2-dihydropyridine-3-carbonitrile, 95+%, 2-Oxo-4,6-bis(trifluoromethyl)-1,2-dihydropyridine-3-carbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 100mg, 1g.
2-oxo-4,6-bis(trifluoromethyl)-1H-pyridine-3-carbonitrile (CAS 3335-15-7) is a chemical compound with the molecular formula C8H2F6N2O and a molecular weight of 256.10 g/mol. IUPAC name: 2-oxo-4,6-bis(trifluoromethyl)-1H-pyridine-3-carbonitrile. InChIKey: DGJXLZTURIWFSZ-UHFFFAOYSA-N.
| Molecular formula | C8H2F6N2O |
|---|---|
| Molecular weight | 256.10 g/mol |
| IUPAC name | 2-oxo-4,6-bis(trifluoromethyl)-1H-pyridine-3-carbonitrile |
| InChIKey | DGJXLZTURIWFSZ-UHFFFAOYSA-N |
| SMILES | C1=C(NC(=O)C(=C1C(F)(F)F)C#N)C(F)(F)F |
Computed by PubChem (NCBI)