CAS 3336-58-1 appears in our catalog under these names: Ammoniumtrifluoroacetate, Ammonium trifluoroacetate, Trifluoroacetic acid, ammonium salt, 98%, Ammonium trifluoroacetate 98%, AMMONIUM TRIFLUOROACETATE, 98%. Offered by: GLPBio, Biosynth, Thermo Scientific (Acros), Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 25g, 0,025kg, 0,05kg, 0,1kg, 1000g, 5g, 500g.
Azanium 2,2,2-trifluoroacetate (CAS 3336-58-1) is a chemical compound with the molecular formula C2H4F3NO2 and a molecular weight of 131.05 g/mol. IUPAC name: azanium 2,2,2-trifluoroacetate. InChIKey: YCNIBOIOWCTRCL-UHFFFAOYSA-N.
| Molecular formula | C2H4F3NO2 |
|---|---|
| Molecular weight | 131.05 g/mol |
| IUPAC name | azanium 2,2,2-trifluoroacetate |
| InChIKey | YCNIBOIOWCTRCL-UHFFFAOYSA-N |
| SMILES | C(=O)(C(F)(F)F)[O-].[NH4+] |
Computed by PubChem (NCBI)