CAS 3337-66-4 appears in our catalog under these names: Methyl 4-hydroxy-3,5-diiodobenzoate 97%, Methyl 4-hydroxy-3,5-diiodobenzoate, 96%, Benzoic acid, 4-hydroxy-3,5-diiodo-, methyl ester, 97%, 97%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g.
Methyl 4-hydroxy-3,5-diiodobenzoate (CAS 3337-66-4) is a chemical compound with the molecular formula C8H6I2O3 and a molecular weight of 403.94 g/mol. IUPAC name: methyl 4-hydroxy-3,5-diiodobenzoate. InChIKey: MBNGCRHTBSWFLS-UHFFFAOYSA-N.
| Molecular formula | C8H6I2O3 |
|---|---|
| Molecular weight | 403.94 g/mol |
| IUPAC name | methyl 4-hydroxy-3,5-diiodobenzoate |
| InChIKey | MBNGCRHTBSWFLS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)I)O)I |
Computed by PubChem (NCBI)