CAS 333740-13-9 is the registry number for MurA-IN-6. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-4-methylbenzamide (CAS 333740-13-9) is a chemical compound with the molecular formula C22H17N3O3S and a molecular weight of 403.5 g/mol. IUPAC name: N-[[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-4-methylbenzamide. InChIKey: PEEANMQODCIZNV-UHFFFAOYSA-N.
| Molecular formula | C22H17N3O3S |
|---|---|
| Molecular weight | 403.5 g/mol |
| IUPAC name | N-[[3-(1,3-benzoxazol-2-yl)-4-hydroxyphenyl]carbamothioyl]-4-methylbenzamide |
| InChIKey | PEEANMQODCIZNV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)NC(=S)NC2=CC(=C(C=C2)O)C3=NC4=CC=CC=C4O3 |
Computed by PubChem (NCBI)