CAS 333771-24-7 appears in our catalog under these names: 5-(3-Bromophenyl)-4-methyl-2,4-dihydro-3h-1,2,4-triazole-3-thione, 95%, 5-(3-Bromophenyl)-4-methyl-4H-1,2,4-triazole-3-thiol, 3-(3-bromophenyl)-4-methyl-4,5-dihydro-1H-1,2,4-triazole-5-thione, 95+%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 1g, 5g, 0,5g, 50mg, 100mg, 250mg, 500mg.
3-(3-bromophenyl)-4-methyl-1H-1,2,4-triazole-5-thione (CAS 333771-24-7) is a chemical compound with the molecular formula C9H8BrN3S and a molecular weight of 270.15 g/mol. IUPAC name: 3-(3-bromophenyl)-4-methyl-1H-1,2,4-triazole-5-thione. InChIKey: BOPAGWTWVHPEEC-UHFFFAOYSA-N.
| Molecular formula | C9H8BrN3S |
|---|---|
| Molecular weight | 270.15 g/mol |
| IUPAC name | 3-(3-bromophenyl)-4-methyl-1H-1,2,4-triazole-5-thione |
| InChIKey | BOPAGWTWVHPEEC-UHFFFAOYSA-N |
| SMILES | CN1C(=NNC1=S)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)