CAS 3338-32-7 appears in our catalog under these names: Z-Asp(otbu)-OSu, 97%, Z–Asp(OtBu)–OSu, Z-L-Asp(OtBu)-OSu, Cbz-Asp(OtBu)-OSu 95%, Z-Asp(otbu)-OSu, 95%, 95%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 1g, 25g, 100g, 5g, 10g, 50g.
4-O-tert-butyl 1-O-(2,5-dioxopyrrolidin-1-yl) (2S)-2-(phenylmethoxycarbonylamino)butanedioate (CAS 3338-32-7) is a chemical compound with the molecular formula C20H24N2O8 and a molecular weight of 420.4 g/mol. IUPAC name: 4-O-tert-butyl 1-O-(2,5-dioxopyrrolidin-1-yl) (2S)-2-(phenylmethoxycarbonylamino)butanedioate. InChIKey: JUMSBOKRGDETHL-AWEZNQCLSA-N.
| Molecular formula | C20H24N2O8 |
|---|---|
| Molecular weight | 420.4 g/mol |
| IUPAC name | 4-O-tert-butyl 1-O-(2,5-dioxopyrrolidin-1-yl) (2S)-2-(phenylmethoxycarbonylamino)butanedioate |
| InChIKey | JUMSBOKRGDETHL-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](C(=O)ON1C(=O)CCC1=O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)