Products 3339-81-9

CAS 3339-81-9 appears in our catalog under these names: 5-(5-Bromothiophen-2-yl)thiophene-2-carboxylic acid, 95%, 5-(5-Bromothiophen-2-yl)thiophene-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

5-(5-bromothiophen-2-yl)thiophene-2-carboxylic acid (CAS 3339-81-9) is a chemical compound with the molecular formula C9H5BrO2S2 and a molecular weight of 289.2 g/mol. IUPAC name: 5-(5-bromothiophen-2-yl)thiophene-2-carboxylic acid. InChIKey: NZFOLHUYXSTVHQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5BrO2S2
Molecular weight289.2 g/mol
IUPAC name5-(5-bromothiophen-2-yl)thiophene-2-carboxylic acid
InChIKeyNZFOLHUYXSTVHQ-UHFFFAOYSA-N
SMILESC1=C(SC(=C1)C(=O)O)C2=CC=C(S2)Br

Computed by PubChem (NCBI)