CAS 33430-61-4 appears in our catalog under these names: 2'-Deoxyguanosine-5'-monophosphate disodium salt, 98%, 2'–Deoxyguanosine 5'–monophosphate disodium, 2'-Deoxyguanosine 5'-monophosphate disodium/ 99.69% (existing batch purity), 2'-Deoxyguanosine-5'-monophosphate disodium salt, Disodium 2'-deoxy-5'-O-phosphonatoguanosine 98%. Offered by: Combi-blocks, GLPBio, TargetMol, Biosynth, Ambeed. Available pack sizes: 1g, 25g, 5g, 100mg, 500mg, 50mg, 2g, 10g.
Disodium;[5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl phosphate (CAS 33430-61-4) is a chemical compound with the molecular formula C10H12N5Na2O7P and a molecular weight of 391.19 g/mol. IUPAC name: disodium;[5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl phosphate. InChIKey: CTPAMSRBXKGZCJ-UHFFFAOYSA-L.
| Molecular formula | C10H12N5Na2O7P |
|---|---|
| Molecular weight | 391.19 g/mol |
| IUPAC name | disodium;[5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl phosphate |
| InChIKey | CTPAMSRBXKGZCJ-UHFFFAOYSA-L |
| SMILES | C1C(C(OC1N2C=NC3=C2N=C(NC3=O)N)COP(=O)([O-])[O-])O.[Na+].[Na+] |
Computed by PubChem (NCBI)