CAS 33436-90-7 appears in our catalog under these names: 2-(Ethylthio)-9H-purin-6-amine, 97%, 2–(Ethylthio)–9H–purin–6–amine. Offered by: AmBeed, GLPBio. Available pack sizes: 250mg, 1g.
2-ethylsulfanyl-7H-purin-6-amine (CAS 33436-90-7) is a chemical compound with the molecular formula C7H9N5S and a molecular weight of 195.25 g/mol. IUPAC name: 2-ethylsulfanyl-7H-purin-6-amine. InChIKey: OYUJKXQJBKRXFI-UHFFFAOYSA-N.
| Molecular formula | C7H9N5S |
|---|---|
| Molecular weight | 195.25 g/mol |
| IUPAC name | 2-ethylsulfanyl-7H-purin-6-amine |
| InChIKey | OYUJKXQJBKRXFI-UHFFFAOYSA-N |
| SMILES | CCSC1=NC(=C2C(=N1)N=CN2)N |
Computed by PubChem (NCBI)