CAS 3344-14-7 is the registry number for S-Methyl Fenitrothion. Offered by: TRC. Available pack sizes: 250mg, 500mg, 50mg.
4-[methoxy(methylsulfanyl)phosphoryl]oxy-2-methyl-1-nitrobenzene (CAS 3344-14-7) is a chemical compound with the molecular formula C9H12NO5PS and a molecular weight of 277.24 g/mol. IUPAC name: 4-[methoxy(methylsulfanyl)phosphoryl]oxy-2-methyl-1-nitrobenzene. InChIKey: OVDMPFAESMMFPC-UHFFFAOYSA-N.
| Molecular formula | C9H12NO5PS |
|---|---|
| Molecular weight | 277.24 g/mol |
| IUPAC name | 4-[methoxy(methylsulfanyl)phosphoryl]oxy-2-methyl-1-nitrobenzene |
| InChIKey | OVDMPFAESMMFPC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OP(=O)(OC)SC)[N+](=O)[O-] |
Computed by PubChem (NCBI)