CAS 33445-20-4 is the registry number for Amitriptyline Methyl Iodide. Offered by: TRC. Available pack sizes: 250mg.
Trimethyl-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]azanium iodide (CAS 33445-20-4) is a chemical compound with the molecular formula C21H26IN and a molecular weight of 419.3 g/mol. IUPAC name: trimethyl-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]azanium iodide. InChIKey: NYKBNKRTRFCKPX-UHFFFAOYSA-M.
| Molecular formula | C21H26IN |
|---|---|
| Molecular weight | 419.3 g/mol |
| IUPAC name | trimethyl-[3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)propyl]azanium iodide |
| InChIKey | NYKBNKRTRFCKPX-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)CCC=C1C2=CC=CC=C2CCC3=CC=CC=C31.[I-] |
Computed by PubChem (NCBI)