CAS 33456-68-7 is the registry number for Gliquidone Impurity 14. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-[2-(7-methoxy-4,4-dimethyl-1,3-dioxoisoquinolin-2-yl)ethyl]benzenesulfonamide (CAS 33456-68-7) is a chemical compound with the molecular formula C20H22N2O5S and a molecular weight of 402.5 g/mol. IUPAC name: 4-[2-(7-methoxy-4,4-dimethyl-1,3-dioxoisoquinolin-2-yl)ethyl]benzenesulfonamide. InChIKey: YJHGEYXLMLMFCF-UHFFFAOYSA-N.
| Molecular formula | C20H22N2O5S |
|---|---|
| Molecular weight | 402.5 g/mol |
| IUPAC name | 4-[2-(7-methoxy-4,4-dimethyl-1,3-dioxoisoquinolin-2-yl)ethyl]benzenesulfonamide |
| InChIKey | YJHGEYXLMLMFCF-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=C(C=C2)OC)C(=O)N(C1=O)CCC3=CC=C(C=C3)S(=O)(=O)N)C |
Computed by PubChem (NCBI)