CAS 334708-05-3 appears in our catalog under these names: 2-Hydroxy-5-sulfopyridine-3-carboxylic acid, 2-Hydroxy-5-sulfonicotinic acid, 95%, 2-Hydroxy-5-sulfonicotinic acid, 95+%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 2,5g, 10g, 5g, 1g, 250mg.
2-oxo-5-sulfo-1H-pyridine-3-carboxylic acid (CAS 334708-05-3) is a chemical compound with the molecular formula C6H5NO6S and a molecular weight of 219.17 g/mol. IUPAC name: 2-oxo-5-sulfo-1H-pyridine-3-carboxylic acid. InChIKey: ZUWITCSMJULFEU-UHFFFAOYSA-N.
| Molecular formula | C6H5NO6S |
|---|---|
| Molecular weight | 219.17 g/mol |
| IUPAC name | 2-oxo-5-sulfo-1H-pyridine-3-carboxylic acid |
| InChIKey | ZUWITCSMJULFEU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC=C1S(=O)(=O)O)C(=O)O |
Computed by PubChem (NCBI)