CAS 334758-22-4 is the registry number for MCPA-carboxylic acid. Offered by: Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 10mg, 1x10mg.
2-(carboxymethoxy)-5-chlorobenzoic acid (CAS 334758-22-4) is a chemical compound with the molecular formula C9H7ClO5 and a molecular weight of 230.60 g/mol. IUPAC name: 2-(carboxymethoxy)-5-chlorobenzoic acid. InChIKey: WXOXOMZXUQKTBM-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO5 |
|---|---|
| Molecular weight | 230.60 g/mol |
| IUPAC name | 2-(carboxymethoxy)-5-chlorobenzoic acid |
| InChIKey | WXOXOMZXUQKTBM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)O)OCC(=O)O |
Computed by PubChem (NCBI)