Products 334829-66-2
CAS 334829-66-2 appears in our catalog under these names: D,L-Sulforaphane N-Acetyl-L-cysteine, >95% (HPLC), DL-Sulforaphane N-acetyl-L-cysteine, DL–Sulforaphane N–acetyl–L–cysteine, D,L-Sulforaphane N-acetyl-L-cysteine, DL-Sulforaphane N-acetyl-L-cysteine, 99.00% ,, 99.00% ,. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 10mg, 1mg, 5mg, 2mg, 25mg, Get quote, 1 mg, 5 mg.
(2R)-2-acetamido-3-(4-methylsulfinylbutylcarbamothioylsulfanyl)propanoic acid (CAS 334829-66-2) is a chemical compound with the molecular formula C11H20N2O4S3 and a molecular weight of 340.5 g/mol. IUPAC name: (2R)-2-acetamido-3-(4-methylsulfinylbutylcarbamothioylsulfanyl)propanoic acid. InChIKey: IIHBKTCHILXGOT-KMYGYIBBSA-N.
| Molecular formula | C11H20N2O4S3 |
|---|---|
| Molecular weight | 340.5 g/mol |
| IUPAC name | (2R)-2-acetamido-3-(4-methylsulfinylbutylcarbamothioylsulfanyl)propanoic acid |
| InChIKey | IIHBKTCHILXGOT-KMYGYIBBSA-N |
| SMILES | CC(=O)N[C@@H](CSC(=S)NCCCCS(=O)C)C(=O)O |
Computed by PubChem (NCBI)