Products 334951-92-7
CAS 334951-92-7 appears in our catalog under these names: MEK inhibitor, MEK inhibitor, MEK inhibitor, ≥98%, ≥98%, MEK inhibitor, 98.35%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 2mg, 25mg, 50mg, 100mg, 10mg, 5mg, 10mM (in 1ml dmso), 1mg.
3-[N-[3-[(dimethylamino)methyl]phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-N-methyl-1H-indole-6-carboxamide (CAS 334951-92-7) is a chemical compound with the molecular formula C26H26N4O2 and a molecular weight of 426.5 g/mol. IUPAC name: 3-[N-[3-[(dimethylamino)methyl]phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-N-methyl-1H-indole-6-carboxamide. InChIKey: UPICVLXBXZXYIE-UHFFFAOYSA-N.
| Molecular formula | C26H26N4O2 |
|---|---|
| Molecular weight | 426.5 g/mol |
| IUPAC name | 3-[N-[3-[(dimethylamino)methyl]phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-N-methyl-1H-indole-6-carboxamide |
| InChIKey | UPICVLXBXZXYIE-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC2=C(C=C1)C(=C(N2)O)C(=NC3=CC=CC(=C3)CN(C)C)C4=CC=CC=C4 |
Computed by PubChem (NCBI)