CAS 335-44-4 appears in our catalog under these names: Heptafluoro-2,3,3-trichlorobutane, 95%, Heptafluoro–2,3,3–trichlorobutane, Heptafluoro-2,3,3-trichlorobutane, ≥97%, ≥97%, Heptafluoro-2,2,3-trichlorobutane. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100g, 1g.
2,2,3-trichloro-1,1,1,3,4,4,4-heptafluorobutane (CAS 335-44-4) is a chemical compound with the molecular formula C4Cl3F7 and a molecular weight of 287.39 g/mol. IUPAC name: 2,2,3-trichloro-1,1,1,3,4,4,4-heptafluorobutane. InChIKey: ZPGMWBFCBUKITA-UHFFFAOYSA-N.
| Molecular formula | C4Cl3F7 |
|---|---|
| Molecular weight | 287.39 g/mol |
| IUPAC name | 2,2,3-trichloro-1,1,1,3,4,4,4-heptafluorobutane |
| InChIKey | ZPGMWBFCBUKITA-UHFFFAOYSA-N |
| SMILES | C(C(C(F)(F)F)(Cl)Cl)(C(F)(F)F)(F)Cl |
Computed by PubChem (NCBI)