CAS 335-50-2 is the registry number for 1-Iodo-1h,1h-perfluorohexane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
1,1,1,2,2,3,3,4,4,5,5-undecafluoro-6-iodohexane (CAS 335-50-2) is a chemical compound with the molecular formula C6H2F11I and a molecular weight of 409.97 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4,5,5-undecafluoro-6-iodohexane. InChIKey: NVPYUCSZZRWYML-UHFFFAOYSA-N.
| Molecular formula | C6H2F11I |
|---|---|
| Molecular weight | 409.97 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4,5,5-undecafluoro-6-iodohexane |
| InChIKey | NVPYUCSZZRWYML-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)I |
Computed by PubChem (NCBI)