CAS 335-64-8 appears in our catalog under these names: Perfluorooctanoyl chloride, 97%, Pentadecafluorooctanoyl chloride, Perfluorooctanoyl chloride, 97% , PENTADECAFLUOROOCTANOYL CHLORIDE, 97%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Sigma-Aldrich. Available pack sizes: 25g, 5g.
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl chloride (CAS 335-64-8) is a chemical compound with the molecular formula C8ClF15O and a molecular weight of 432.51 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl chloride. InChIKey: AQQBRCXWZZAFOK-UHFFFAOYSA-N.
| Molecular formula | C8ClF15O |
|---|---|
| Molecular weight | 432.51 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl chloride |
| InChIKey | AQQBRCXWZZAFOK-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)Cl |
Computed by PubChem (NCBI)