CAS 335-65-9 is the registry number for 1H-Perfluorooctane, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluorooctane (CAS 335-65-9) is a chemical compound with the molecular formula C8HF17 and a molecular weight of 420.07 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluorooctane. InChIKey: KBHBUUBXEQUIMV-UHFFFAOYSA-N.
| Molecular formula | C8HF17 |
|---|---|
| Molecular weight | 420.07 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluorooctane |
| InChIKey | KBHBUUBXEQUIMV-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)