CAS 335-70-6 appears in our catalog under these names: 1,8-Diiodoperfluorooctane, 95%, 1,8-Diiodoperfluorooctane, >95% (GC), Hexadecafluoro–1,8–diiodooctane, HEXADECAFLUORO-1,8-DIIODOOCTANE, 98%. Offered by: Combi-blocks, TRC, GLPBio, Sigma-Aldrich. Available pack sizes: 5g, 1g, 250mg.
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-1,8-diiodooctane (CAS 335-70-6) is a chemical compound with the molecular formula C8F16I2 and a molecular weight of 653.87 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-1,8-diiodooctane. InChIKey: SRDQTCUHAMDAMG-UHFFFAOYSA-N.
| Molecular formula | C8F16I2 |
|---|---|
| Molecular weight | 653.87 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-1,8-diiodooctane |
| InChIKey | SRDQTCUHAMDAMG-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(F)(F)I)(F)F)(F)F)(F)F)(C(C(C(F)(F)I)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)