CAS 335-74-0 is the registry number for 3,5,7,9,10-Pentachloro-2,2,3,4,4,5,6,6,7,8,8,9,10,10-tetradecafluorodecanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5,7,9,10-pentachloro-2,2,3,4,4,5,6,6,7,8,8,9,10,10-tetradecafluorodecanoic acid (CAS 335-74-0) is a chemical compound with the molecular formula C10HCl5F14O2 and a molecular weight of 596.3 g/mol. IUPAC name: 3,5,7,9,10-pentachloro-2,2,3,4,4,5,6,6,7,8,8,9,10,10-tetradecafluorodecanoic acid. InChIKey: ADMOCDJEQJUWJY-UHFFFAOYSA-N.
| Molecular formula | C10HCl5F14O2 |
|---|---|
| Molecular weight | 596.3 g/mol |
| IUPAC name | 3,5,7,9,10-pentachloro-2,2,3,4,4,5,6,6,7,8,8,9,10,10-tetradecafluorodecanoic acid |
| InChIKey | ADMOCDJEQJUWJY-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(C(C(C(C(C(C(C(F)(F)Cl)(F)Cl)(F)F)(F)Cl)(F)F)(F)Cl)(F)F)(F)Cl)(F)F)O |
Computed by PubChem (NCBI)