CAS 335-77-3 appears in our catalog under these names: Perfluorodecanesulfonic Acid (50ug/ml in Methanol), Perfluorodecane Sulfonic Acid, >95% (HPLC), Perfluorodecanesulfonic acid, Perfluorodecanesulfonic acid 50 µg/mL in Methanol:Water, Perfluorodecanesulfonic Acid. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Roth, HPC Standards. Available pack sizes: 50x1ml, 25mg, 50mg, 5mg, 1ml, 1mg, 1x1ml.
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane-1-sulfonic acid (CAS 335-77-3) is a chemical compound with the molecular formula C10HF21O3S and a molecular weight of 600.15 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane-1-sulfonic acid. InChIKey: HYWZIAVPBSTISZ-UHFFFAOYSA-N.
| Molecular formula | C10HF21O3S |
|---|---|
| Molecular weight | 600.15 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane-1-sulfonic acid |
| InChIKey | HYWZIAVPBSTISZ-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(F)(F)S(=O)(=O)O)(F)F)(F)F)(F)F)(F)F)(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)