CAS 335-93-3 appears in our catalog under these names: Silver perfluorooctanoate, 95%, Silver perfluorooctanoate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 2g.
Silver 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate (CAS 335-93-3) is a chemical compound with the molecular formula C8AgF15O2 and a molecular weight of 520.93 g/mol. IUPAC name: silver 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate. InChIKey: HXWHIGAHMKKVBV-UHFFFAOYSA-M.
| Molecular formula | C8AgF15O2 |
|---|---|
| Molecular weight | 520.93 g/mol |
| IUPAC name | silver 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate |
| InChIKey | HXWHIGAHMKKVBV-UHFFFAOYSA-M |
| SMILES | C(=O)(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)[O-].[Ag+] |
Computed by PubChem (NCBI)