Products 33500-88-8

CAS 33500-88-8 is the registry number for 1-Bromo-2-methoxy-4,5-dimethylbenzene, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

1-bromo-2-methoxy-4,5-dimethylbenzene (CAS 33500-88-8) is a chemical compound with the molecular formula C9H11BrO and a molecular weight of 215.09 g/mol. IUPAC name: 1-bromo-2-methoxy-4,5-dimethylbenzene. InChIKey: NETNPXCTGLWDJK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11BrO
Molecular weight215.09 g/mol
IUPAC name1-bromo-2-methoxy-4,5-dimethylbenzene
InChIKeyNETNPXCTGLWDJK-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1C)Br)OC

Computed by PubChem (NCBI)