CAS 335096-46-3 is the registry number for 1-(4-hydroxybenzoate)-D-Glucitol. Offered by: Chemat Brand. Available pack sizes: on request.
[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl] 4-hydroxybenzoate (CAS 335096-46-3) is a chemical compound with the molecular formula C13H18O8 and a molecular weight of 302.28 g/mol. IUPAC name: [(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl] 4-hydroxybenzoate. InChIKey: IMHQKRJHCKVIRE-WRWGMCAJSA-N.
| Molecular formula | C13H18O8 |
|---|---|
| Molecular weight | 302.28 g/mol |
| IUPAC name | [(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl] 4-hydroxybenzoate |
| InChIKey | IMHQKRJHCKVIRE-WRWGMCAJSA-N |
| SMILES | C1=CC(=CC=C1C(=O)OC[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O)O |
Computed by PubChem (NCBI)