CAS 3351-05-1 appears in our catalog under these names: Acid Blue 113 (Technical Grade), Acid Blue 113. Offered by: TRC, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, 25g, 50g, 250g, 10 mg, 100 mg.
Disodium;8-anilino-5-[[4-[(3-sulfonatophenyl)diazenyl]naphthalen-1-yl]diazenyl]naphthalene-1-sulfonate (CAS 3351-05-1) is a chemical compound with the molecular formula C32H21N5Na2O6S2 and a molecular weight of 681.7 g/mol. IUPAC name: disodium;8-anilino-5-[[4-[(3-sulfonatophenyl)diazenyl]naphthalen-1-yl]diazenyl]naphthalene-1-sulfonate. InChIKey: XPRMZBUQQMPKCR-UHFFFAOYSA-L.
| Molecular formula | C32H21N5Na2O6S2 |
|---|---|
| Molecular weight | 681.7 g/mol |
| IUPAC name | disodium;8-anilino-5-[[4-[(3-sulfonatophenyl)diazenyl]naphthalen-1-yl]diazenyl]naphthalene-1-sulfonate |
| InChIKey | XPRMZBUQQMPKCR-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C=C1)NC2=C3C(=C(C=C2)N=NC4=CC=C(C5=CC=CC=C54)N=NC6=CC(=CC=C6)S(=O)(=O)[O-])C=CC=C3S(=O)(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)