CAS 335125-98-9 appears in our catalog under these names: 2,3',4',5'-Tetrafluorobiphenyl-4-ol, 95%, 2,3',4',5'-Tetrafluoro-(1,1'-biphenyl)-4-ol, 97%, 2,3'',4'',5''–Tetrafluorobiphenyl–4–ol, 2,3',4',5'-Tetrafluoro-[1,1'-biphenyl]-4-ol, 2,3',4',5'-TETRAFLUOROBIPHENYL-4-OL. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 100mg, 250mg.
3-fluoro-4-(3,4,5-trifluorophenyl)phenol (CAS 335125-98-9) is a chemical compound with the molecular formula C12H6F4O and a molecular weight of 242.17 g/mol. IUPAC name: 3-fluoro-4-(3,4,5-trifluorophenyl)phenol. InChIKey: BMSYKBWEFGWDKT-UHFFFAOYSA-N.
| Molecular formula | C12H6F4O |
|---|---|
| Molecular weight | 242.17 g/mol |
| IUPAC name | 3-fluoro-4-(3,4,5-trifluorophenyl)phenol |
| InChIKey | BMSYKBWEFGWDKT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)F)C2=CC(=C(C(=C2)F)F)F |
Computed by PubChem (NCBI)