Products 335193-70-9
CAS 335193-70-9 appears in our catalog under these names: BODIPY R6G NHS ester, BDP R6G NHS ester, 95%. Offered by: MedChemExpress, Lumiprobe. Available pack sizes: 10 mg, 50 mg, 100 mg, 25 mg, 5 mg, 1mg, 5mg, 25mg.
(2,5-dioxopyrrolidin-1-yl) 3-(2,2-difluoro-12-phenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-4-yl)propanoate (CAS 335193-70-9) is a chemical compound with the molecular formula C22H18BF2N3O4 and a molecular weight of 437.2 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-(2,2-difluoro-12-phenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-4-yl)propanoate. InChIKey: AAMQZFYOSUWKRX-UHFFFAOYSA-N.
| Molecular formula | C22H18BF2N3O4 |
|---|---|
| Molecular weight | 437.2 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-(2,2-difluoro-12-phenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-4-yl)propanoate |
| InChIKey | AAMQZFYOSUWKRX-UHFFFAOYSA-N |
| SMILES | [B-]1(N2C(=CC=C2CCC(=O)ON3C(=O)CCC3=O)C=C4[N+]1=C(C=C4)C5=CC=CC=C5)(F)F |
Computed by PubChem (NCBI)