CAS 3353-89-7 appears in our catalog under these names: Triphenylsulfonium bromide, 98%, Triphenylsulfonium bromide, Triphenylsulfonium Bromide, >98.0%(T), Triphenylsulfoniumbromide 95%, Triphenylsulfoniumbromide, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 100mg, 5g, 1g, 500g, 10g, 25g, 100g, 15g.
Triphenylsulfanium bromide (CAS 3353-89-7) is a chemical compound with the molecular formula C18H15BrS and a molecular weight of 343.3 g/mol. IUPAC name: triphenylsulfanium bromide. InChIKey: VMJFYMAHEGJHFH-UHFFFAOYSA-M.
| Molecular formula | C18H15BrS |
|---|---|
| Molecular weight | 343.3 g/mol |
| IUPAC name | triphenylsulfanium bromide |
| InChIKey | VMJFYMAHEGJHFH-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)[S+](C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)