CAS 335387-29-6 is the registry number for 2-Chloro-n-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-chloro-N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]acetamide (CAS 335387-29-6) is a chemical compound with the molecular formula C11H7Cl3N2OS and a molecular weight of 321.6 g/mol. IUPAC name: 2-chloro-N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]acetamide. InChIKey: QHNSPZAJVUZNHC-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl3N2OS |
|---|---|
| Molecular weight | 321.6 g/mol |
| IUPAC name | 2-chloro-N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]acetamide |
| InChIKey | QHNSPZAJVUZNHC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=CSC(=N2)NC(=O)CCl |
Computed by PubChem (NCBI)