CAS 33576-72-6 is the registry number for Fenchlorphos-D6, >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
Sulfanylidene-(2,4,5-trichlorophenoxy)-bis(trideuteriomethoxy)-lambda5-phosphane (CAS 33576-72-6) is a chemical compound with the molecular formula C8H8Cl3O3PS and a molecular weight of 327.6 g/mol. IUPAC name: sulfanylidene-(2,4,5-trichlorophenoxy)-bis(trideuteriomethoxy)-lambda5-phosphane. InChIKey: JHJOOSLFWRRSGU-WFGJKAKNSA-N.
| Molecular formula | C8H8Cl3O3PS |
|---|---|
| Molecular weight | 327.6 g/mol |
| IUPAC name | sulfanylidene-(2,4,5-trichlorophenoxy)-bis(trideuteriomethoxy)-lambda5-phosphane |
| InChIKey | JHJOOSLFWRRSGU-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])OP(=S)(OC1=CC(=C(C=C1Cl)Cl)Cl)OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)