CAS 336-07-2 appears in our catalog under these names: 1H,6H-Perfluorohexane, 95%, 1H,6H-Perfluorohexane, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 25g.
1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane (CAS 336-07-2) is a chemical compound with the molecular formula C6H2F12 and a molecular weight of 302.06 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane. InChIKey: UYDBQWIWVMBDME-UHFFFAOYSA-N.
| Molecular formula | C6H2F12 |
|---|---|
| Molecular weight | 302.06 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane |
| InChIKey | UYDBQWIWVMBDME-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)